| Product Name | 4-isobutylmorpholine |
| CAS No. | 10315-98-7 |
| Synonyms | Isobutylmorpholine; 4-(2-methylpropyl)morpholine |
| InChI | InChI=1/C8H17NO/c1-8(2)7-9-3-5-10-6-4-9/h8H,3-7H2,1-2H3 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.2267 |
| Density | 0.897g/cm3 |
| Boiling point | 179.5°C at 760 mmHg |
| Flash point | 49.8°C |
| Refractive index | 1.441 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10315-98-7 4-isobutylmorpholine
service@apichina.com