| Product Name | 4-Isobutylacetophenone |
| CAS No. | 38861-78-8 |
| Synonyms | 4-Isobutylacetaphenone; TIMTEC-BB SBB007668; P-ISO-BUTYLACETOPHENONE; IBUPROFEN IMPURITY E; IBUPROFEN IMP E; ISOBUTYL ACETOPHENONE; 4'-ISOBUTYLACETOPHENONE; 1-[4-(2-METHYLPROPYL)PHENYL]ETHANONE; 4-methyl-3-phenylpentan-2-one; 4'-(2-Methylpropyl)Acetophenone |
| InChI | InChI=1/C12H16O/c1-9(2)12(10(3)13)11-7-5-4-6-8-11/h4-9,12H,1-3H3 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.2548 |
| Density | 0.944g/cm3 |
| Boiling point | 240.8°C at 760 mmHg |
| Flash point | 87°C |
| Refractive index | 1.494 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
38861-78-8 4-isobutylacetophenone
service@apichina.com