| Product Name | 4-iodophenyl isothiocyanate |
| CAS No. | 2059-76-9 |
| Synonyms | 4-Iodoisothiocyanatobenzene; 1-iodo-4-isothiocyanatobenzene |
| InChI | InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Formula | C7H4INS |
| Molecular Weight | 261.0828 |
| Density | 1.76g/cm3 |
| Melting point | 70-76℃ |
| Boiling point | 299.5°C at 760 mmHg |
| Flash point | 134.9°C |
| Refractive index | 1.672 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2059-76-9 4-iodophenyl isothiocyanate
service@apichina.com