| Product Name | 4-iodophenyl isocyanate |
| CAS No. | 15845-62-2 |
| Synonyms | 4-Iodoisocyanatobenzene; 1-iodo-4-isocyanatobenzene |
| InChI | InChI=1/C7H4INO/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Formula | C7H4INO |
| Molecular Weight | 245.0172 |
| Density | 1.79g/cm3 |
| Melting point | 44-48℃ |
| Boiling point | 248°C at 760 mmHg |
| Flash point | 103.8°C |
| Refractive index | 1.636 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15845-62-2 4-iodophenyl isocyanate
service@apichina.com