| Product Name | 4-Iodobenzylamine |
| CAS No. | 39959-59-6 |
| Synonyms | 4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
| InChI | InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| Molecular Formula | C7H8IN |
| Molecular Weight | 233.0496 |
| Density | 1.772g/cm3 |
| Boiling point | 250.4°C at 760 mmHg |
| Flash point | 105.2°C |
| Refractive index | 1.644 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
39959-59-6 4-iodobenzylamine
service@apichina.com