| Product Name | 4-iodo-5-methyl-1-phenyl-1H-pyrazole |
| CAS No. | 342405-19-0 |
| InChI | InChI=1/C10H9IN2/c1-8-10(11)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.0963 |
| Density | 1.68g/cm3 |
| Melting point | 65℃ |
| Boiling point | 332.8°C at 760 mmHg |
| Flash point | 155°C |
| Refractive index | 1.669 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
342405-19-0 4-iodo-5-methyl-1-phenyl-1h-pyrazole
service@apichina.com