| Product Name | 4-iodo-2-methylaniline |
| CAS No. | 13194-68-8 |
| Synonyms | 2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
| InChI | InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| Molecular Formula | C7H8IN |
| Molecular Weight | 233.0496 |
| Density | 1.791g/cm3 |
| Melting point | 86-89℃ |
| Boiling point | 278.4°C at 760 mmHg |
| Flash point | 122.1°C |
| Refractive index | 1.663 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
13194-68-8 4-iodo-2-methylaniline
service@apichina.com