| Product Name | 4-iodo-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one |
| CAS No. | 129-81-7 |
| Synonyms | 4-iodophenazone; 4-iodoanalgesine; 4-iodo-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one; Iodoantipyrine |
| InChI | InChI=1/C11H11IN2O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| Molecular Formula | C11H11IN2O |
| Molecular Weight | 314.1223 |
| Density | 1.77g/cm3 |
| Boiling point | 325.9°C at 760 mmHg |
| Flash point | 150.9°C |
| Refractive index | 1.697 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
129-81-7 4-iodo-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one
service@apichina.com
- Next:129-83-9 phenampromide
- Previous:129-79-3 2,4,7-trinitrofluoren-9-one