| Product Name | 4-Hydroxyphenyl benzoate |
| CAS No. | 2444-19-1 |
| Synonyms | Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
| InChI | InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.2167 |
| Density | 1.25g/cm3 |
| Boiling point | 376.6°C at 760 mmHg |
| Flash point | 164.7°C |
| Refractive index | 1.615 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2444-19-1 4-hydroxyphenyl benzoate
service@apichina.com