| Product Name | 4-Hydroxynonanophenone |
| CAS No. | 14392-69-9 |
| Synonyms | 4-n-Nonanoylphenol; 1-(4-hydroxyphenyl)nonan-1-one |
| InChI | InChI=1/C15H22O2/c1-2-3-4-5-6-7-8-15(17)13-9-11-14(16)12-10-13/h9-12,16H,2-8H2,1H3 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.334 |
| Density | 0.997g/cm3 |
| Boiling point | 379°C at 760 mmHg |
| Flash point | 161.8°C |
| Refractive index | 1.512 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
14392-69-9 4-hydroxynonanophenone
service@apichina.com