| Product Name | 4-(Hydroxymethyl)-5-methylimidazole hydrochloride |
| CAS No. | 29636-87-1 |
| Synonyms | 5-methyl-1h-imidazole-4-methano |
| InChI | InChI=1/C5H8N2O/c1-4-5(2-8)7-3-6-4/h3,8H,2H2,1H3,(H,6,7) |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.1298 |
| Density | 1.231g/cm3 |
| Boiling point | 389.1°C at 760 mmHg |
| Flash point | 189.1°C |
| Refractive index | 1.574 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29636-87-1 4-(hydroxymethyl)-5-methylimidazole hydrochloride
service@apichina.com