| Product Name | 4-Hydroxychalcone |
| CAS No. | 20426-12-4 |
| Synonyms | 4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| InChI | InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.2546 |
| Density | 1.191g/cm3 |
| Melting point | 183-185℃ |
| Boiling point | 394.9°C at 760 mmHg |
| Flash point | 168.6°C |
| Refractive index | 1.653 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20426-12-4 4-hydroxychalcone
service@apichina.com