| Product Name | 4-Hydroxybutyric acid, sodium salt |
| CAS No. | 502-85-2 |
| Synonyms | Sodium Oxybate; 4-Hydroxybutyric acid sodium salt; Sodium 4-hydroxybutyrate; Gamma-Hydroxybutyrate Sodium Salt; sodium 4-hydroxybutanoate |
| InChI | InChI=1/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
| Molecular Formula | C4H7NaO3 |
| Molecular Weight | 126.0863 |
| Melting point | 143-147℃ |
| Boiling point | 295.6°C at 760 mmHg |
| Flash point | 146.8°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
502-85-2 4-hydroxybutyric acid, sodium salt
service@apichina.com