| Product Name | 4-Hydroxybenzal Acetone |
| CAS No. | 3160-35-8 |
| Synonyms | 4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
| InChI | InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.1852 |
| Density | 1.138g/cm3 |
| Boiling point | 318.1°C at 760 mmHg |
| Flash point | 134.8°C |
| Refractive index | 1.599 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3160-35-8 4-hydroxybenzal acetone
service@apichina.com