| Sales Email | Service@apichina.com |
| CAS No. | 4966-90-9 |
| Product Name | 4-Hydroxy-6-methyl-3-nitro-2-pyridone |
| Synonyms | 2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
| InChI | InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.1228 |
| Density | 1.53g/cm3 |
| Melting point | 293-296℃ |
| Boiling point | 265.6°C at 760 mmHg |
| Flash point | 114.4°C |
| Refractive index | 1.608 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
