| Product Name | 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine |
| CAS No. | 68087-13-8 |
| Synonyms | 6-(methoxymethyl)-2-(methylsulfanyl)pyrimidin-4(1H)-one |
| InChI | InChI=1/C7H10N2O2S/c1-11-4-5-3-6(10)9-7(8-5)12-2/h3H,4H2,1-2H3,(H,8,9,10) |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.2315 |
| Density | 1.3g/cm3 |
| Boiling point | 286.6°C at 760 mmHg |
| Flash point | 127.2°C |
| Refractive index | 1.588 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
service@apichina.com