| Product Name | 4-Hydroxy-3-nitropyridine N-oxide |
| CAS No. | 31872-57-8 |
| Synonyms | 3-NITROPYRIDIN-4-OL 1-OXIDE; 3-NITRO-4-PYRIDINOL 1-OXIDE; 3-NITRO-4-HYDROXYPYRIDINE-N-OXIDE; 3-Nitro-4-pyridinol N-oxide; 4-Hydroxy-3-nitropyridine N-oxide 97+%; 1-hydroxy-3-nitropyridin-4(1H)-one |
| InChI | InChI=1/C5H4N2O4/c8-5-1-2-6(9)3-4(5)7(10)11/h1-3,9H |
| Molecular Formula | C5H4N2O4 |
| Molecular Weight | 156.0963 |
| Density | 1.67g/cm3 |
| Boiling point | 287.7°C at 760 mmHg |
| Flash point | 127.8°C |
| Refractive index | 1.657 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
31872-57-8 4-hydroxy-3-nitropyridine n-oxide
service@apichina.com