| Product Name | 4-Hydroxy-3-nitrocoumarin |
| CAS No. | 20261-31-8 |
| Synonyms | 3-NITRO-4-HYDROXYCOUMARIN; 2-hydroxy-3-nitro-4H-chromen-4-one; 4-hydroxy-3-nitro-2H-chromen-2-one |
| InChI | InChI=1/C9H5NO5/c11-8-5-3-1-2-4-6(5)15-9(12)7(8)10(13)14/h1-4,11H |
| Molecular Formula | C9H5NO5 |
| Molecular Weight | 207.1397 |
| Density | 1.638g/cm3 |
| Melting point | 171-173℃ |
| Boiling point | 364.492°C at 760 mmHg |
| Flash point | 174.239°C |
| Refractive index | 1.674 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20261-31-8 4-hydroxy-3-nitrocoumarin
service@apichina.com