| Product Name | 4-hydroxy-3,5-diiodobenzoic acid |
| CAS No. | 618-76-8 |
| Synonyms | 3,5-Diiodo-4-hydroxybenzoic acid |
| InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| Molecular Formula | C7H4I2O3 |
| Molecular Weight | 389.9138 |
| Density | 2.697g/cm3 |
| Boiling point | 346.4°C at 760 mmHg |
| Flash point | 163.3°C |
| Refractive index | 1.784 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
618-76-8 4-hydroxy-3,5-diiodobenzoic acid
service@apichina.com