| Product Name | 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine |
| CAS No. | 175204-69-0 |
| Synonyms | 4-hydrazinyl-6-(pyridin-2-yl)-1,3,5-triazin-2-amine |
| InChI | InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-3-1-2-4-11-5/h1-4H,10H2,(H3,9,12,13,14,15) |
| Molecular Formula | C8H9N7 |
| Molecular Weight | 203.204 |
| Density | 1.488g/cm3 |
| Melting point | 287℃ |
| Boiling point | 550.8°C at 760 mmHg |
| Flash point | 286.9°C |
| Refractive index | 1.756 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175204-69-0 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine
service@apichina.com