| Product Name | 4-hydrazino-2,6-dimethylpyrimidine |
| CAS No. | 14331-56-7 |
| Synonyms | 4-hydrazinyl-2,6-dimethylpyrimidine; (1S)-1-phenylpropan-1-ol |
| InChI | InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.191 |
| Density | 0.994g/cm3 |
| Melting point | 182℃ |
| Boiling point | 219°C at 760 mmHg |
| Flash point | 97.3°C |
| Refractive index | 1.524 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
service@apichina.com