| Product Name | 4-Hexylphenol |
| CAS No. | 2446-69-7 |
| Synonyms | Phenol, 4-hexyl-; 4-n-Hexylphenol; p-n-Hexylphenol; Phenol, p-hexyl-; p-Hexylphenol |
| InChI | InChI=1/C12H18O/c1-2-3-4-5-6-11-7-9-12(13)10-8-11/h7-10,13H,2-6H2,1H3 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.2707 |
| Density | 0.954g/cm3 |
| Melting point | 32℃ |
| Boiling point | 281.2°C at 760 mmHg |
| Flash point | 148.1°C |
| Refractive index | 1.514 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2446-69-7 4-hexylphenol
service@apichina.com