| Product Name | 4-heptylaniline |
| CAS No. | 37529-27-4 |
| Synonyms | Heptylaniline; 4-n-Heptyaniline |
| InChI | InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.3125 |
| Density | 0.923g/cm3 |
| Boiling point | 282.9°C at 760 mmHg |
| Flash point | 128.9°C |
| Refractive index | 1.522 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
37529-27-4 4-heptylaniline
service@apichina.com