| Product Name | 4-formyl-1-methylpyridinium benzenesulfo nate |
| CAS No. | 82228-89-5 |
| Synonyms | 4-Formyl-1-methylpyridinium benzenesulfonate; pyridinium, 4-formyl-1-methyl- benzenesulfonate (1:1) |
| InChI | InChI=1/C7H8NO.C6H6O3S/c1-8-4-2-7(6-9)3-5-8;7-10(8,9)6-4-2-1-3-5-6/h2-6H,1H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.3116 |
| Melting point | 95℃ |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
82228-89-5 4-formyl-1-methylpyridinium benzenesulfo nate
service@apichina.com