| Product Name | (4-fluorophenylthio)acetic acid |
| CAS No. | 332-51-4 |
| Synonyms | 2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
| InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Molecular Formula | C8H6FO2S |
| Molecular Weight | 185.196 |
| Melting point | 76-79℃ |
| Boiling point | 315.4°C at 760 mmHg |
| Flash point | 144.5°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
332-51-4 (4-fluorophenylthio)acetic acid
service@apichina.com