| Product Name | 4-Fluorophenoxy-ethylbromide |
| CAS No. | 332-48-9 |
| Synonyms | 1-(2-Bromoethoxy)-4-fluorobenzene; 1-(1-bromoethoxy)-4-fluorobenzene |
| InChI | InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
| Molecular Formula | C8H8BrFO |
| Molecular Weight | 219.0509 |
| Density | 1.483g/cm3 |
| Boiling point | 242.309°C at 760 mmHg |
| Flash point | 119.849°C |
| Refractive index | 1.525 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
332-48-9 4-fluorophenoxy-ethylbromide
service@apichina.com