| Product Name | 4-fluoroglutamic acid |
| CAS No. | 2708-77-2 |
| Synonyms | 4-Fluoro-DL-glutamic acid; DL-4-Fluoroglutamic acid; H-4-F-DL-Glu-OH; 4-fluoro-L-glutamic acid |
| InChI | InChI=1/C5H8FNO4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)/t2?,3-/m0/s1 |
| Molecular Formula | C5H8FNO4 |
| Molecular Weight | 165.1197 |
| Density | 1.498g/cm3 |
| Boiling point | 342.4°C at 760 mmHg |
| Flash point | 160.9°C |
| Refractive index | 1.491 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
2708-77-2 4-fluoroglutamic acid
service@apichina.com