| Product Name | 4-Fluorochalcone |
| CAS No. | 1608-51-1 |
| Synonyms | 1-Phenyl-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylideneacetophenone; 3-(4-fluorophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-fluorophenyl)-1-phenylprop-2-en-1-one |
| InChI | InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| Molecular Formula | C15H11FO |
| Molecular Weight | 226.2456 |
| Density | 1.166g/cm3 |
| Melting point | 84℃ |
| Boiling point | 345.9°C at 760 mmHg |
| Flash point | 157.3°C |
| Refractive index | 1.608 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1608-51-1 4-fluorochalcone
service@apichina.com