| Product Name | 4-Fluorobenzyl mercaptan |
| CAS No. | 15894-04-9 |
| Synonyms | 4-Fluoro-alpha-toluenethiol; 4-Fluoro benzyl mercaptan; p-Fluorotoluene-alpha-thiol; Benzenemethanethiol, 4-fluoro-; p-fluorotoluene-α-thiol; (4-fluorophenyl)methanethiol; 6-fluoro-2-methylquinolin-4(1H)-one |
| InChI | InChI=1/C10H8FNO/c1-6-4-10(13)8-5-7(11)2-3-9(8)12-6/h2-5H,1H3,(H,12,13) |
| Molecular Formula | C10H8FNO |
| Molecular Weight | 177.175 |
| Density | 1.228g/cm3 |
| Boiling point | 275.7°C at 760 mmHg |
| Flash point | 120.5°C |
| Refractive index | 1.553 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
15894-04-9 4-fluorobenzyl mercaptan
service@apichina.com