| Product Name | 4-fluorobenzyl isothiocyanate |
| CAS No. | 2740-88-7 |
| Synonyms | 4-Fluoro-(isothiocyanatomethyl)-benzene |
| InChI | InChI=1/C8H6FNS/c9-8-3-1-7(2-4-8)5-10-6-11/h1-4H,5H2 |
| Molecular Formula | C8H6FNS |
| Molecular Weight | 167.20 |
| Density | 1.22 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2740-88-7 4-fluorobenzyl isothiocyanate
service@apichina.com