| Product Name | 4-Fluoroacetophenone oxime |
| CAS No. | 329-79-3 |
| Synonyms | Acetophenone, 4'-fluoro-, oxime; 4'-Fluoroacetophenone oxime; BRN 2086063; NSC 154663; Ethanone, 1-(4-fluorophenyl)-, oxime (9CI); 1-(4-fluorophenyl)-N-hydroxyethanimine; (1E)-1-(4-fluorophenyl)ethanone oxime; (1Z)-1-(4-fluorophenyl)ethanone oxime |
| InChI | InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.1536 |
| Density | 1.12g/cm3 |
| Melting point | 72℃ |
| Boiling point | 239.8°C at 760 mmHg |
| Flash point | 98.8°C |
| Refractive index | 1.503 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
329-79-3 4-fluoroacetophenone oxime
service@apichina.com