| Product Name | 4-Fluoro-3-(trifluoromethyl)anisole |
| CAS No. | 127271-65-2 |
| Synonyms | 2-Fluoro-5-methoxybenzotrifluoride; 4-fluoro-3-trifluoromethylanisole; 1-fluoro-4-methoxy-2-(trifluoromethyl)benzene; 4-bromo-2-fluoro-1-propoxybenzene; 3-Trifluoromethyl-4-Fluoroanisole; 2-Fluoro-5-(trifluoromethyl)anisole |
| InChI | InChI=1/C9H10BrFO/c1-2-5-12-9-4-3-7(10)6-8(9)11/h3-4,6H,2,5H2,1H3 |
| Molecular Formula | C9H10BrFO |
| Molecular Weight | 233.0775 |
| Density | 1.397g/cm3 |
| Boiling point | 251.471°C at 760 mmHg |
| Flash point | 128.816°C |
| Refractive index | 1.51 |
| Risk Codes | R10:Flammable.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
127271-65-2 4-fluoro-3-(trifluoromethyl)anisole
service@apichina.com