| Product Name | 4-Fluoro-3-methylbenzoic acid |
| CAS No. | 403-15-6 |
| Synonyms | 4-Fluoro-m-toluic acid; 4-fluoro-3-methylbenzoate |
| InChI | InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
| Molecular Formula | C8H6FO2 |
| Molecular Weight | 153.131 |
| Melting point | 166-169℃ |
| Boiling point | 266.3°C at 760 mmHg |
| Flash point | 114.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
403-15-6 4-fluoro-3-methylbenzoic acid
service@apichina.com