| Product Name | 4-Fluoro-3-hydroxybenzoic acid |
| CAS No. | 51446-31-2 |
| Synonyms | (4-fluorophenyl)(3-phenyloxiran-2-yl)methanone; 4-fluoro-3-hydroxybenzoate; 3-Hydroxy-4-fluorobenzoic acid |
| InChI | InChI=1/C7H5FO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)/p-1 |
| Molecular Formula | C7H4FO3 |
| Molecular Weight | 155.1038 |
| Boiling point | 324°C at 760 mmHg |
| Flash point | 149.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
51446-31-2 4-fluoro-3-hydroxybenzoic acid
service@apichina.com