| Product Name | 4-Fluoro-3-formylbenzeneboronic acid |
| CAS No. | 374538-01-9 |
| Synonyms | 5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
| InChI | InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
| Molecular Formula | C7H6BFO3 |
| Molecular Weight | 167.9301 |
| Density | 1.33g/cm3 |
| Boiling point | 342.9°C at 760 mmHg |
| Flash point | 161.2°C |
| Refractive index | 1.524 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374538-01-9 4-fluoro-3-formylbenzeneboronic acid
service@apichina.com