| Product Name | 4-fluoro-2-(trifluoromethyl)acetophenone |
| CAS No. | 208173-21-1 |
| Synonyms | 4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
| InChI | InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.165 |
| Density | 1.127g/cm3 |
| Boiling point | 246°C at 760 mmHg |
| Flash point | 99.6°C |
| Refractive index | 1.487 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
service@apichina.com