| Product Name | 4-fluoro-1-naphthoic acid |
| CAS No. | 573-03-5 |
| Synonyms | 4-Fluoro-1-naphthoic acid; 4-fluoronaphthalene-1-carboxylic acid; 4-fluoronaphthalene-1-carboxylate; 4-Fluoro-1-naphthoicacid |
| InChI | InChI=1/C11H7FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H,(H,13,14)/p-1 |
| Molecular Formula | C11H6FO2 |
| Molecular Weight | 189.1631 |
| Melting point | 223-227℃ |
| Boiling point | 370.8°C at 760 mmHg |
| Flash point | 178°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
573-03-5 4-fluoro-1-naphthoic acid
service@apichina.com