| Product Name | 4-Fluoro-1-iodo-2-nitrobenzene |
| CAS No. | 364-77-2 |
| Synonyms | 2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
| InChI | InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Molecular Formula | C6H5FN2O2 |
| Molecular Weight | 156.1145 |
| Density | 1.448g/cm3 |
| Boiling point | 295.1°C at 760 mmHg |
| Flash point | 89.4°C |
| Refractive index | 1.603 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
364-77-2 4-fluoro-1-iodo-2-nitrobenzene
service@apichina.com