| Product Name | 4-Ethynylbenzoic acid sodium salt |
| CAS No. | 144693-65-2 |
| Synonyms | (4-Carboxyphenyl)acetylene sodium salt~Sodium 4-ethynylbenzoate; sodium 4-ethynylbenzoate |
| InChI | InChI=1/C9H6O2.Na/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);/q;+1/p-1 |
| Molecular Formula | C9H5NaO2 |
| Molecular Weight | 168.1246 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
144693-65-2 4-ethynylbenzoic acid sodium salt
service@apichina.com