| Product Name | 4-Ethylthiophenol |
| CAS No. | 4946-13-8 |
| Synonyms | 4-Ethylbenzenethiol; 4-ethylbenzenethiolate |
| InChI | InChI=1/C8H10S/c1-2-7-3-5-8(9)6-4-7/h3-6,9H,2H2,1H3/p-1 |
| Molecular Formula | C8H9S |
| Molecular Weight | 137.2226 |
| Boiling point | 211.7°C at 760 mmHg |
| Flash point | 84°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36:Irritating to eyes.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4946-13-8 4-ethylthiophenol
service@apichina.com