| Product Name | 4-(ethylthio)benzoic acid |
| CAS No. | 13205-49-7 |
| Synonyms | 4-(ethylsulfanyl)benzoic acid |
| InChI | InChI=1/C9H10O2S/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.2395 |
| Density | 1.23g/cm3 |
| Melting point | 145-147℃ |
| Boiling point | 329.8°C at 760 mmHg |
| Flash point | 153.2°C |
| Refractive index | 1.596 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13205-49-7 4-(ethylthio)benzoic acid
service@apichina.com