| Product Name | 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine |
| CAS No. | 175204-60-1 |
| Synonyms | 4-(ethylsulfanyl)-6-(1-methylethyl)-1,3,5-triazin-2-amine |
| InChI | InChI=1/C8H14N4S/c1-4-13-8-11-6(5(2)3)10-7(9)12-8/h5H,4H2,1-3H3,(H2,9,10,11,12) |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.2886 |
| Density | 1.17g/cm3 |
| Melting point | 114℃ |
| Boiling point | 404.7°C at 760 mmHg |
| Flash point | 198.6°C |
| Refractive index | 1.565 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-60-1 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine
service@apichina.com