| Product Name | 4-Ethylphenylboronic acid |
| CAS No. | 63139-21-9 |
| Synonyms | 4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
| InChI | InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.9827 |
| Density | 1.07g/cm3 |
| Melting point | 150-155℃ |
| Boiling point | 285.1°C at 760 mmHg |
| Flash point | 126.2°C |
| Refractive index | 1.521 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
63139-21-9 4-ethylphenylboronic acid
service@apichina.com