| Product Name | 4-Ethylphenylacetonitrile |
| CAS No. | 51632-28-1 |
| Synonyms | 4-Ethylbenzyl cyanide |
| InChI | InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.201 |
| Density | 0.978g/cm3 |
| Boiling point | 252.8°C at 760 mmHg |
| Flash point | 116.1°C |
| Refractive index | 1.521 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
51632-28-1 4-ethylphenylacetonitrile
service@apichina.com