| Product Name | 4-Ethylphenyl isothiocyanate |
| CAS No. | 18856-63-8 |
| Synonyms | 4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| InChI | InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.2395 |
| Density | 1.01g/cm3 |
| Boiling point | 257.8°C at 760 mmHg |
| Flash point | 110.2°C |
| Refractive index | 1.553 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18856-63-8 4-ethylphenyl isothiocyanate
service@apichina.com