| Product Name | 4-ethylphenyl isocyanate |
| CAS No. | 23138-50-3 |
| Synonyms | 4-Ethylisocyanatobenzene; 1-ethyl-4-isocyanatobenzene |
| InChI | InChI=1/C9H9NO/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.1739 |
| Density | 0.98g/cm3 |
| Boiling point | 208.1°C at 760 mmHg |
| Flash point | 71.7°C |
| Refractive index | 1.514 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
23138-50-3 4-ethylphenyl isocyanate
service@apichina.com