| Product Name | (4-Ethylphenoxy)-acetic acid |
| CAS No. | 24431-27-4 |
| Synonyms | 4-Ethylphenoxyacetic acid |
| InChI | InChI=1/C10H12O3/c1-2-8-3-5-9(6-4-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.144g/cm3 |
| Boiling point | 309.6°C at 760 mmHg |
| Flash point | 121.6°C |
| Refractive index | 1.53 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
24431-27-4 (4-ethylphenoxy)-acetic acid
service@apichina.com