| Product Name | 4-Ethyliodobenzene |
| CAS No. | 25309-64-2 |
| Synonyms | 1-Ethyl-4-iodobenzene; 2-chlorocyclohexyl oxo(phenyl)acetate |
| InChI | InChI=1/C8H9I/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| Molecular Formula | C8H9I |
| Molecular Weight | 232.0615 |
| Density | 1.607g/cm3 |
| Boiling point | 209.6°C at 760 mmHg |
| Flash point | 88.6°C |
| Refractive index | 1.59 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
25309-64-2 4-ethyliodobenzene
service@apichina.com