| Product Name | 4-Ethylcatechol |
| CAS No. | 1124-39-6 |
| Synonyms | 3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
| InChI | InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.1638 |
| Density | 1.159g/cm3 |
| Boiling point | 273.3°C at 760 mmHg |
| Flash point | 134.1°C |
| Refractive index | 1.578 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1124-39-6 4-ethylcatechol
service@apichina.com