| Product Name | 4-(Ethylamino)benzoic acid |
| CAS No. | 7409-09-8 |
| InChI | InChI=1/C9H11NO2/c1-2-10-8-5-3-7(4-6-8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12) |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.197g/cm3 |
| Melting point | 178℃ |
| Boiling point | 330.9°C at 760 mmHg |
| Flash point | 153.9°C |
| Refractive index | 1.603 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7409-09-8 4-(ethylamino)benzoic acid
service@apichina.com